CymitQuimica logo

CAS 885498-76-0

:

4,4-Diethoxy-3,8,11,14,17,20-hexaoxa-4-siladocosane

Description:
4,4-Diethoxy-3,8,11,14,17,20-hexaoxa-4-siladocosane is a synthetic chemical compound characterized by its unique siloxane structure, which incorporates both silicon and oxygen atoms in its backbone. This compound features a long-chain structure with multiple ether linkages, specifically diethoxy groups, which contribute to its solubility and potential applications in various fields, including materials science and organic synthesis. The presence of silicon in the structure enhances thermal stability and mechanical properties, making it suitable for use in high-performance materials. Additionally, the compound's multiple ether functionalities may impart hydrophilic characteristics, influencing its interaction with water and other solvents. Its specific applications could range from use in coatings and adhesives to potential roles in drug delivery systems, depending on its reactivity and compatibility with other substances. As with any chemical, safety data and handling precautions should be reviewed before use, particularly due to the potential for reactivity associated with its functional groups.
Formula:C19H42O8Si
InChI:InChI=1S/C19H42O8Si/c1-5-20-11-12-22-15-16-24-18-17-23-14-13-21-10-9-19-28(25-6-2,26-7-3)27-8-4/h5-19H2,1-4H3
InChI key:InChIKey=RJGHOFONEVTJRY-UHFFFAOYSA-N
SMILES:[Si](CCCOCCOCCOCCOCCOCC)(OCC)(OCC)OCC
Synonyms:
  • 4,4-Diethoxy-3,8,11,14,17,20-hexaoxa-4-siladocosane
  • 3,8,11,14,17,20-Hexaoxa-4-siladocosane, 4,4-diethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.