CymitQuimica logo

CAS 885498-80-6

:

4,4-Diethoxy-3,8,11,14,17-pentaoxa-4-silanonadecane

Description:
4,4-Diethoxy-3,8,11,14,17-pentaoxa-4-silanonadecane is a siloxane compound characterized by its unique structure that includes both silane and ether functionalities. This compound features a long carbon chain with multiple ether linkages, which contribute to its potential applications in materials science, particularly in the development of surfactants, lubricants, or as a polymer additive. The presence of diethoxy groups enhances its solubility in organic solvents and may improve its compatibility with various substrates. Additionally, the siloxane backbone imparts thermal stability and flexibility, making it suitable for use in diverse chemical environments. The compound's molecular structure suggests it may exhibit interesting properties such as low surface tension and good wetting characteristics. However, specific physical and chemical properties, such as boiling point, melting point, and reactivity, would need to be determined through experimental methods or detailed literature review, as they are not universally available for all compounds. Overall, 4,4-Diethoxy-3,8,11,14,17-pentaoxa-4-silanonadecane represents a class of compounds with potential utility in various industrial applications.
Formula:C17H38O7Si
InChI:InChI=1S/C17H38O7Si/c1-5-18-11-12-20-15-16-21-14-13-19-10-9-17-25(22-6-2,23-7-3)24-8-4/h5-17H2,1-4H3
InChI key:InChIKey=JCDXAYIXOPQNLX-UHFFFAOYSA-N
SMILES:[Si](CCCOCCOCCOCCOCC)(OCC)(OCC)OCC
Synonyms:
  • 3,8,11,14,17-Pentaoxa-4-silanonadecane, 4,4-diethoxy-
  • 4,4-Diethoxy-3,8,11,14,17-pentaoxa-4-silanonadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.