CymitQuimica logo

CAS 885499-57-0

:

1-(1H-Pyrrolo[2,3-b]pyridin-4-yl)-4-piperidinamine

Description:
1-(1H-Pyrrolo[2,3-b]pyridin-4-yl)-4-piperidinamine, with the CAS number 885499-57-0, is a chemical compound characterized by its unique bicyclic structure that incorporates a pyrrolo[2,3-b]pyridine moiety and a piperidinamine group. This compound typically exhibits properties such as moderate to high solubility in polar solvents, which is common for nitrogen-containing heterocycles. It may possess biological activity, potentially acting as a pharmacological agent due to its structural features that allow for interactions with biological targets, such as receptors or enzymes. The presence of both the pyridine and piperidine rings suggests potential for hydrogen bonding and other interactions, which can influence its reactivity and stability. Additionally, the compound's molecular weight and specific functional groups may contribute to its lipophilicity and overall pharmacokinetic profile. As with many heterocyclic compounds, it may be of interest in medicinal chemistry for the development of new therapeutic agents.
Formula:C12H16N4
InChI:InChI=1S/C12H16N4/c13-9-3-7-16(8-4-9)11-2-6-15-12-10(11)1-5-14-12/h1-2,5-6,9H,3-4,7-8,13H2,(H,14,15)
InChI key:InChIKey=ZFBACGKIDNXYRK-UHFFFAOYSA-N
SMILES:NC1CCN(C2=C3C(=NC=C2)NC=C3)CC1
Synonyms:
  • 1-(1H-Pyrrolo[2,3-b]pyridin-4-yl)-4-piperidinamine
  • 1-(1H-Pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amin
  • 4-piperidinamine, 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-
  • [1-(1H-Pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-yl]amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.