CAS 88551-99-9
:(3Z)-1,1,1-trifluoro-4-sulfanylpent-3-en-2-one
Description:
(3Z)-1,1,1-trifluoro-4-sulfanylpent-3-en-2-one, with the CAS number 88551-99-9, is an organic compound characterized by the presence of a trifluoromethyl group and a thiol (sulfanyl) functional group. This compound features a pentene backbone with a double bond at the 3-position, which is in the Z configuration, indicating that the highest priority substituents on the double bond are on the same side. The trifluoromethyl group contributes to its unique chemical properties, including increased electronegativity and potential reactivity in nucleophilic substitution reactions. The sulfanyl group can impart distinct reactivity patterns, particularly in thiol-related chemistry. This compound may exhibit interesting biological activities and could be of interest in various fields, including medicinal chemistry and materials science. Its stability, solubility, and reactivity can be influenced by the presence of the trifluoromethyl and sulfanyl groups, making it a subject of study for potential applications in synthesis and drug development.
Formula:C5H5F3OS
InChI:InChI=1/C5H5F3OS/c1-3(10)2-4(9)5(6,7)8/h2,10H,1H3/b3-2-
SMILES:C/C(=C/C(=O)C(F)(F)F)/S
Synonyms:- 3-Penten-2-one, 1,1,1-trifluoro-4-mercapto
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
