CymitQuimica logo

CAS 885518-12-7

:

4-Methoxy-1H-indol-6-amine

Description:
4-Methoxy-1H-indol-6-amine, with the CAS number 885518-12-7, is an organic compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound is characterized by the presence of a methoxy group (-OCH3) at the 4-position and an amino group (-NH2) at the 6-position of the indole ring. These functional groups contribute to its chemical reactivity and potential biological activity. The methoxy group can influence the compound's solubility and electronic properties, while the amino group can participate in hydrogen bonding and act as a nucleophile. 4-Methoxy-1H-indol-6-amine may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves methods that allow for selective functionalization of the indole ring, and it may be studied for its potential applications in treating various diseases or as a biochemical probe. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in analytical applications.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-12-9-5-6(10)4-8-7(9)2-3-11-8/h2-5,11H,10H2,1H3
InChI key:InChIKey=OMDJRLJKLOICLC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(N)=C1)NC=C2
Synonyms:
  • 4-Methoxy-1H-indol-6-amine
  • 1H-Indol-6-amine, 4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.