CymitQuimica logo

CAS 885518-52-5

:

1H-Indazole-4,6-diamine

Description:
1H-Indazole-4,6-diamine, with the CAS number 885518-52-5, is an organic compound characterized by its indazole core structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features amino groups at the 4 and 6 positions of the indazole ring, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups and their arrangement. The presence of amino groups suggests that it can participate in hydrogen bonding and may act as a ligand in coordination chemistry. 1H-Indazole-4,6-diamine has garnered interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization are important for understanding its reactivity and potential uses in various chemical and pharmaceutical applications. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of study in materials science.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c8-4-1-6(9)5-3-10-11-7(5)2-4/h1-3H,8-9H2,(H,10,11)
InChI key:InChIKey=GPZNSPPUBKLUSM-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(N)=C1)NN=C2
Synonyms:
  • 1H-Indazole-4,6-diamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.