CAS 885518-58-1
:4,6-Dibromo-1,2-dihydro-3H-indazol-3-one
Description:
4,6-Dibromo-1,2-dihydro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features two bromine atoms substituted at the 4 and 6 positions of the indazole ring, contributing to its reactivity and potential biological activity. The presence of the carbonyl group (C=O) at the 3 position enhances its properties, making it a subject of interest in medicinal chemistry. Typically, compounds like this may exhibit various pharmacological activities, including antimicrobial or anticancer properties, due to the influence of halogen substituents on biological interactions. The molecular structure allows for potential interactions with biological targets, making it valuable in drug development. Additionally, its solubility and stability can vary based on the solvent and conditions, which is crucial for its application in research and industry. Overall, 4,6-Dibromo-1,2-dihydro-3H-indazol-3-one represents a significant compound in the study of heterocyclic chemistry and its applications in pharmaceuticals.
Formula:C7H4Br2N2O
InChI:InChI=1S/C7H4Br2N2O/c8-3-1-4(9)6-5(2-3)10-11-7(6)12/h1-2H,(H2,10,11,12)
InChI key:InChIKey=OWRKXUACQHVSMG-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(Br)=C1)NNC2=O
Synonyms:- 3H-Indazol-3-one, 4,6-dibromo-1,2-dihydro-
- 4,6-Dibromo-1,2-dihydro-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
