CAS 885518-59-2
:4-Bromo-6-nitro-1H-indazole-3-carbonitrile
Description:
4-Bromo-6-nitro-1H-indazole-3-carbonitrile is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a nitro group at the 6-position contributes to its reactivity and potential applications in various chemical reactions. The carbonitrile functional group at the 3-position enhances its polarity and can influence its solubility in organic solvents. This compound is often utilized in medicinal chemistry and material science due to its unique structural features, which may impart biological activity or facilitate interactions with other molecules. Its molecular structure allows for potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of halogen and nitro groups can enhance its electronic properties, making it a candidate for further functionalization or incorporation into larger molecular frameworks. As with many chemical substances, safety and handling precautions should be observed due to its potential toxicity and reactivity.
Formula:C8H3BrN4O2
InChI:InChI=1S/C8H3BrN4O2/c9-5-1-4(13(14)15)2-6-8(5)7(3-10)12-11-6/h1-2H,(H,11,12)
InChI key:InChIKey=BWPLCIKGEAWQIL-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(=CC(N(=O)=O)=CC2Br)NN1
Synonyms:- 4-Bromo-6-nitro-1H-indazole-3-carbonitrile
- 1H-Indazole-3-carbonitrile, 4-bromo-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
