CAS 885518-68-3
:1H-Indazole, 3-bromo-4-iodo-
Description:
1H-Indazole, 3-bromo-4-iodo- is a heterocyclic organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of bromine and iodine substituents at the 3 and 4 positions, respectively, introduces significant reactivity and influences its chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can enhance biological activity and facilitate further chemical modifications. Additionally, the compound may exhibit interesting electronic properties owing to the halogen substituents, which can affect its reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and proper handling procedures should be followed in laboratory settings.
Formula:C7H4BrIN2
InChI:InChI=1S/C7H4BrIN2/c8-7-6-4(9)2-1-3-5(6)10-11-7/h1-3H,(H,10,11)
InChI key:InChIKey=MVOVURPDTBOZEP-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC=C1)NN=C2Br
Synonyms:- 1H-Indazole, 3-bromo-4-iodo-
- 3-Bromo-4-iodo-1H-indazole
- 3-Bromo-4-iodo-2H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
