CAS 885518-74-1
:4-Iodo-1H-indazole-3-carboxylic acid
Description:
4-Iodo-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 4-position and a carboxylic acid functional group at the 3-position contributes to its unique reactivity and properties. This compound typically appears as a solid and is soluble in polar solvents, reflecting the influence of the carboxylic acid group. It may exhibit acidic behavior due to the carboxylic acid, allowing it to participate in various chemical reactions, such as esterification or amidation. The iodine substituent can also enhance the compound's reactivity in nucleophilic substitution reactions. 4-Iodo-1H-indazole-3-carboxylic acid is of interest in medicinal chemistry and material science, potentially serving as a building block for the synthesis of biologically active molecules or functional materials. Its specific applications and biological activities would depend on further studies and research.
Formula:C8H5IN2O2
InChI:InChI=1S/C8H5IN2O2/c9-4-2-1-3-5-6(4)7(8(12)13)11-10-5/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=JDXXIOOVFOGOHH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NN1)=CC=CC2I
Synonyms:- 4-Iodo-1H-indazole-3-carboxylic acid
- 1H-Indazole-3-carboxylic acid, 4-iodo-
- 4-Iodo-3-(1H)indazole carbocylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Iodo-1H-indazole-3-carboxylic acid
CAS:4-Iodo-1H-indazole-3-carboxylic acid
Color and Shape:Yellow SolidMolecular weight:288.04g/mol

