
CAS 885518-78-5
:1,2-Dihydro-6-iodo-3H-indazol-3-one
Description:
1,2-Dihydro-6-iodo-3H-indazol-3-one is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a carbonyl group (C=O) at the 3-position, which is typical for indazoles and can influence its biological activity. The dihydro form indicates that the compound has two hydrogen atoms added to the indazole structure, which may affect its stability and solubility. The compound is likely to exhibit various pharmacological properties, making it of interest in drug development. Its CAS number, 885518-78-5, allows for easy identification in chemical databases. Overall, 1,2-Dihydro-6-iodo-3H-indazol-3-one is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C7H5IN2O
InChI:InChI=1S/C7H5IN2O/c8-4-1-2-5-6(3-4)9-10-7(5)11/h1-3H,(H2,9,10,11)
InChI key:InChIKey=SEDSJTLREIWHOW-UHFFFAOYSA-N
SMILES:O=C1C=2C(NN1)=CC(I)=CC2
Synonyms:- 3H-Indazol-3-one, 1,2-dihydro-6-iodo-
- 1,2-Dihydro-6-iodo-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.