CymitQuimica logo

CAS 885518-87-6

:

4,6-Dimethoxy-1H-indazole-3-carboxaldehyde

Description:
4,6-Dimethoxy-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features two methoxy groups (-OCH3) at the 4 and 6 positions of the indazole ring, contributing to its unique chemical properties and potential reactivity. The presence of a carboxaldehyde functional group (-CHO) at the 3 position enhances its reactivity, making it suitable for various synthetic applications, including in medicinal chemistry and organic synthesis. The methoxy groups can influence the compound's solubility, polarity, and overall biological activity. Additionally, this compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its CAS number, 885518-87-6, allows for easy identification and reference in chemical databases. Overall, 4,6-Dimethoxy-1H-indazole-3-carboxaldehyde is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-14-6-3-7-10(9(4-6)15-2)8(5-13)12-11-7/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=OEDBGKJYQGRQOD-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1)NN=C2C=O
Synonyms:
  • 1H-Indazole-3-carboxaldehyde, 4,6-dimethoxy-
  • 4,6-Dimethoxy-1H-indazole-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.