CAS 885518-95-6

1-Bromo-5-chloro-2-methyl-3-nitrobenzene

Description:

1-Bromo-5-chloro-2-methyl-3-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a chlorine atom, a methyl group, and a nitro group attached to a benzene ring. This compound features a complex substitution pattern, with the bromine and chlorine atoms providing significant reactivity due to their electronegative nature. The nitro group, known for its strong electron-withdrawing properties, enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The methyl group contributes to the overall hydrophobic character of the molecule, influencing its solubility in organic solvents. Additionally, the presence of multiple halogens and a nitro group can impart unique physical properties, such as increased density and potential for forming hydrogen bonds. This compound may be utilized in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex chemical entities. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.

Formula: C₇H₅BrClNO₂

InChI: InChI=1S/C7H5BrClNO2/c1-4-6(8)2-5(9)3-7(4)10(11)12/h2-3H,1H3

InChI key: InChIKey=PONMYPMRWXBYEV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C)C(Br)=CC(Cl)=C1

Synonyms:

• 1-Bromo-5-chloro-2-methyl-3-nitrobenzene
• 2-Bromo-4-chloro-6-nitrotoluene
• Benzene, 1-bromo-5-chloro-2-methyl-3-nitro-

1-Bromo-5-chloro-2-methyl-3-nitrobenzene

CAS: 885518-95-6

Formula: C₇H₅BrClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 250.4771

Ref: IN-DA003GNW

1-Bromo-5-chloro-2-methyl-3-nitrobenzene

CAS: 885518-95-6

1-Bromo-5-chloro-2-methyl-3-nitrobenzene

Purity: 98%

Molecular weight: 250.48g/mol

Ref: 54-OR90046

1-Bromo-5-chloro-2-methyl-3-nitrobenzene

CAS: 885518-95-6

Formula: C₇H₅BrClNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 250.48

Ref: 10-F338196