CAS 885518-98-9
:6-Methyl-1H-indazole-3-carboxaldehyde
Description:
6-Methyl-1H-indazole-3-carboxaldehyde is an organic compound characterized by its indazole structure, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a methyl group at the 6-position and a carboxaldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is soluble in common organic solvents, which facilitates its use in various chemical reactions. The aldehyde functional group makes it a versatile intermediate for further chemical transformations, such as condensation reactions and the synthesis of more complex molecules. Additionally, compounds like 6-Methyl-1H-indazole-3-carboxaldehyde may exhibit biological activity, making them of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-6-2-3-7-8(4-6)10-11-9(7)5-12/h2-5H,1H3,(H,10,11)
InChI key:InChIKey=MFQJCMCRICBIOP-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC(C)=CC2
Synonyms:- 1H-Indazole-3-carboxaldehyde, 6-methyl-
- 6-Methyl-1H-indazole-3-carboxaldehyde
- 6-Methyl-1H-indazole-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
