CAS 885518-99-0

6-Bromo-4-chloro-1H-indazole

Description:

6-Bromo-4-chloro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of bromine and chlorine substituents at the 6 and 4 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, reflecting its non-polar characteristics due to the aromatic nature of the indazole structure. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the electron-withdrawing effects of the halogen substituents. Additionally, 6-Bromo-4-chloro-1H-indazole has garnered interest in medicinal chemistry for its potential biological activities, including anti-cancer and anti-inflammatory properties. Its molecular structure allows for interactions with biological targets, making it a subject of research in drug development. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.

Formula: C₇H₄BrClN₂

InChI: InChI=1S/C7H4BrClN2/c8-4-1-6(9)5-3-10-11-7(5)2-4/h1-3H,(H,10,11)

InChI key: InChIKey=MOYPLQILACEGCD-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(Br)=C1)NN=C2

Synonyms:

• 6-Bromo-4-chloro-1H-indazole
• 1H-Indazole, 6-bromo-4-chloro-

6-Bromo-4-chloro-1H-indazole

CAS: 885518-99-0

Formula: C₇H₄BrClN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 231.4771

Ref: IN-DA0034C9

6-Bromo-4-chloro-1H-indazole

CAS: 885518-99-0

6-Bromo-4-chloro-1H-indazole

Purity: 98%

Molecular weight: 231.48g/mol

Ref: 54-OR90283

6-Bromo-4-chloro-1H-indazole

CAS: 885518-99-0

Formula: C₇H₄BrClN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 231.48

Ref: 10-F218421

6-Bromo-4-chloro-1H-indazole

CAS: 885518-99-0

6-Bromo-4-chloro-1H-indazole is an organic compound that has been reported as a reaction component, reagent, and useful scaffold in the synthesis of complex compounds. It is also a speciality chemical with versatile building block and useful intermediate properties. 6-Bromo-4-chloro-1H-indazole is a fine chemical with complex structure and high purity.

Formula: C₇H₄BrClN₂

Purity: Min. 95%

Color and Shape: Off-white to brown solid.

Molecular weight: 231.48 g/mol

Ref: 3D-FB15379