CAS 885519-09-5
:Methyl 3-iodo-6-nitro-1H-indazole-4-carboxylate
Description:
Methyl 3-iodo-6-nitro-1H-indazole-4-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a nitro group at the 6-position and an iodo substituent at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The carboxylate group at the 4-position, esterified with a methyl group, enhances its solubility and reactivity, making it suitable for various chemical transformations. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular structure suggests potential uses in drug development, particularly in the synthesis of novel pharmacophores. As with many halogenated and nitro compounds, it is essential to handle this substance with care, considering its potential toxicity and environmental impact. Proper safety protocols should be followed when working with this chemical in laboratory settings.
Formula:C9H6IN3O4
InChI:InChI=1S/C9H6IN3O4/c1-17-9(14)5-2-4(13(15)16)3-6-7(5)8(10)12-11-6/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=DJLJUJXSBAPPBZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=CC(N(=O)=O)=C1)NN=C2I
Synonyms:- 1H-Indazole-4-carboxylic acid, 3-iodo-6-nitro-, methyl ester
- Methyl 3-iodo-6-nitro-1H-indazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
