CAS 885519-24-4
:6-Amino-1H-indazole-3-carboxaldehyde
Description:
6-Amino-1H-indazole-3-carboxaldehyde is an organic compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a formyl group (-CHO) attached to the indazole ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group allows for hydrogen bonding and can enhance solubility in polar solvents, while the aldehyde group can participate in various chemical reactions, such as condensation and oxidation. This compound is often utilized in the synthesis of more complex molecules and may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure and functional groups suggest potential roles in drug development, particularly in targeting specific biological pathways. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any risks associated with its use.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-5-1-2-6-7(3-5)10-11-8(6)4-12/h1-4H,9H2,(H,10,11)
InChI key:InChIKey=BJMVTLDXBPHHBP-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC(N)=CC2
Synonyms:- 1H-Indazole-3-carboxaldehyde, 6-amino-
- 6-Amino-1H-indazole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.