CAS 885519-25-5
:4-Chloro-3-iodo-6-nitro-1H-indazole
Description:
4-Chloro-3-iodo-6-nitro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of chlorine, iodine, and nitro groups at specific positions on the indazole structure contributes to its unique chemical properties and reactivity. The chlorine atom typically enhances the compound's electrophilicity, while the nitro group can serve as a strong electron-withdrawing substituent, influencing its reactivity in various chemical reactions. The iodine atom may also impart specific characteristics such as increased lipophilicity and potential for nucleophilic substitution reactions. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. Its molecular structure allows for various interactions, making it a candidate for further research in drug development and other applications. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C7H3ClIN3O2
InChI:InChI=1S/C7H3ClIN3O2/c8-4-1-3(12(13)14)2-5-6(4)7(9)11-10-5/h1-2H,(H,10,11)
InChI key:InChIKey=VTLMWXADEHEFRL-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(N(=O)=O)=C1)NN=C2I
Synonyms:- 4-Chloro-3-iodo-6-nitro-1H-indazole
- 1H-Indazole, 4-chloro-3-iodo-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
