CAS 885519-26-6
:5-Amino-1H-indazole-3-carboxaldehyde
Description:
5-Amino-1H-indazole-3-carboxaldehyde is an organic compound characterized by its indazole core, which features an amino group and an aldehyde functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino and aldehyde groups, which can engage in hydrogen bonding. The indazole structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the amino group can facilitate interactions with biological targets, while the aldehyde group may participate in various chemical reactions, such as condensation or reduction. Its molecular structure allows for potential applications in the synthesis of more complex molecules or as a building block in pharmaceutical research. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-5-1-2-7-6(3-5)8(4-12)11-10-7/h1-4H,9H2,(H,10,11)
InChI key:InChIKey=XTNNTXYVRNVHGB-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC=C(N)C2
Synonyms:- 5-Amino-1H-indazole-3-carboxaldehyde
- 1H-Indazole-3-carboxaldehyde, 5-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
