CAS 885519-31-3
:6-Amino-4-chloro-1H-indazole-3-carboxylic acid
Description:
6-Amino-4-chloro-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which features an amino group and a carboxylic acid functional group. The presence of a chlorine atom at the 4-position of the indazole ring contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both amino and carboxylic acid functionalities that can participate in various chemical reactions. The compound may exhibit biological activities, making it of interest for research in areas such as drug discovery and development. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may have specific toxicity or reactivity profiles.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c9-4-1-3(10)2-5-6(4)7(8(13)14)12-11-5/h1-2H,10H2,(H,11,12)(H,13,14)
InChI key:InChIKey=DKZAEXCINRTQSD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(N)=CC2Cl)NN1
Synonyms:- 1H-Indazole-3-carboxylic acid, 6-amino-4-chloro-
- 6-Amino-4-chloro-1H-indazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
