CymitQuimica logo

CAS 885519-33-5

:

Methyl 4-iodo-1H-indazole-6-carboxylate

Description:
Methyl 4-iodo-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of the iodine atom at the 4-position of the indazole ring contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The carboxylate functional group, derived from the carboxylic acid, is esterified with a methyl group, enhancing its solubility in organic solvents and making it suitable for various synthetic applications. This compound is often utilized in medicinal chemistry and drug development due to its structural features that may exhibit biological activity. Additionally, the presence of the iodine atom can facilitate further functionalization, making it a valuable intermediate in organic synthesis. Its molecular structure and properties make it a subject of interest for researchers exploring new pharmaceuticals or agrochemicals. As with many halogenated compounds, safety precautions should be observed when handling this substance due to potential toxicity and environmental impact.
Formula:C9H7IN2O2
InChI:InChI=1S/C9H7IN2O2/c1-14-9(13)5-2-7(10)6-4-11-12-8(6)3-5/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=FZBDWCSGYBKAOD-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(C(OC)=O)=C1)NN=C2
Synonyms:
  • Methyl 4-iodo-1H-indazole-6-carboxylate
  • 1H-Indazole-6-carboxylic acid, 4-iodo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.