CymitQuimica logo

CAS 885519-35-7

:

6-Chloro-1,2-dihydro-4-nitro-3H-indazol-3-one

Description:
6-Chloro-1,2-dihydro-4-nitro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and a nitro group at the 4-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. It is often utilized in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The nitro group can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which may be explored in drug discovery processes. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and reactivity.
Formula:C7H4ClN3O3
InChI:InChI=1S/C7H4ClN3O3/c8-3-1-4-6(7(12)10-9-4)5(2-3)11(13)14/h1-2H,(H2,9,10,12)
InChI key:InChIKey=JFMMQKRHTABPSK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NNC2=O)=CC(Cl)=C1
Synonyms:
  • 6-Chloro-1,2-dihydro-4-nitro-3H-indazol-3-one
  • 3H-Indazol-3-one, 6-chloro-1,2-dihydro-4-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.