CymitQuimica logo

CAS 885519-52-8

:

N-(5-Chloro-2-methyl-3-nitrophenyl)acetamide

Description:
N-(5-Chloro-2-methyl-3-nitrophenyl)acetamide, with the CAS number 885519-52-8, is an organic compound characterized by its acetamide functional group attached to a substituted aromatic ring. The presence of a chloro group, a methyl group, and a nitro group on the phenyl ring contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic substitution reactions. Additionally, the chloro substituent can participate in nucleophilic substitution reactions, making this compound potentially useful in various synthetic applications. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which it is analyzed. Overall, N-(5-Chloro-2-methyl-3-nitrophenyl)acetamide is of interest in medicinal chemistry and materials science due to its structural features.
Formula:C9H9ClN2O3
InChI:InChI=1S/C9H9ClN2O3/c1-5-8(11-6(2)13)3-7(10)4-9(5)12(14)15/h3-4H,1-2H3,(H,11,13)
InChI key:InChIKey=NRNXULRCOHMJHS-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(C)C(N(=O)=O)=CC(Cl)=C1
Synonyms:
  • Acetamide, N-(5-chloro-2-methyl-3-nitrophenyl)-
  • N-(5-Chloro-2-methyl-3-nitrophenyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.