CAS 885519-53-9

3-Bromo-4,6-dinitro-1H-indazole

Description:

3-Bromo-4,6-dinitro-1H-indazole is a chemical compound characterized by its unique structure, which includes a bromine atom and two nitro groups attached to an indazole ring. This compound typically exhibits a yellow to orange color and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the nitro groups contributes to its reactivity, making it a candidate for further chemical modifications. It is generally stable under standard conditions but may undergo reactions typical of nitro compounds, such as reduction or nucleophilic substitution. The bromine substituent can also participate in electrophilic aromatic substitution reactions. Safety data sheets should be consulted for handling and storage guidelines, as compounds with nitro groups can pose hazards. Overall, 3-Bromo-4,6-dinitro-1H-indazole is a compound of interest for research due to its distinctive properties and potential utility in synthetic chemistry.

Formula: C₇H₃BrN₄O₄

InChI: InChI=1S/C7H3BrN4O4/c8-7-6-4(9-10-7)1-3(11(13)14)2-5(6)12(15)16/h1-2H,(H,9,10)

InChI key: InChIKey=PILNASVTIBPOLG-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=CC(N(=O)=O)=C1)NN=C2Br

Synonyms:

• 1H-Indazole, 3-bromo-4,6-dinitro-
• 3-Bromo-4,6-dinitro-1H-indazole