CymitQuimica logo

CAS 885519-62-0

:

6-Chloro-4-methoxy-1H-indazole

Description:
6-Chloro-4-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and a methoxy group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 6-Chloro-4-methoxy-1H-indazole represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C8H7ClN2O
InChI:InChI=1S/C8H7ClN2O/c1-12-8-3-5(9)2-7-6(8)4-10-11-7/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=TXZHYSDVONQYFJ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(Cl)=C1)NN=C2
Synonyms:
  • 6-Chloro-4-methoxy-1H-indazole
  • 1H-Indazole, 6-chloro-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.