CAS 885519-63-1
:3-Bromo-6-nitro-1H-indazole-4-carboxylic acid
Description:
3-Bromo-6-nitro-1H-indazole-4-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a nitro group at the 6-position contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group at the 4-position enhances its acidity and solubility in polar solvents, making it useful in synthetic organic chemistry. This compound may exhibit biological activity, which is often explored in medicinal chemistry for potential therapeutic applications. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (carboxylic acid) groups can influence its electronic properties, affecting its reactivity and interaction with biological targets. Overall, 3-Bromo-6-nitro-1H-indazole-4-carboxylic acid is a significant compound in research and development within the fields of organic and medicinal chemistry.
Formula:C8H4BrN3O4
InChI:InChI=1S/C8H4BrN3O4/c9-7-6-4(8(13)14)1-3(12(15)16)2-5(6)10-11-7/h1-2H,(H,10,11)(H,13,14)
InChI key:InChIKey=XICVTHNEBURAOZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(N(=O)=O)=C1)NN=C2Br
Synonyms:- 1H-Indazole-4-carboxylic acid, 3-bromo-6-nitro-
- 3-Bromo-6-nitro-1H-indazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
