
CAS 885519-68-6
:6-Chloro-3-iodo-4-methoxy-1H-indazole
Description:
6-Chloro-3-iodo-4-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of chlorine and iodine substituents at the 6 and 3 positions, respectively, introduces significant halogen functionality, which can influence the compound's reactivity and biological activity. The methoxy group at the 4 position enhances the compound's lipophilicity and may affect its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its unique combination of halogen atoms and a methoxy group may also provide opportunities for further chemical modifications and the development of derivatives with improved efficacy or selectivity. As with many indazole derivatives, the specific characteristics, such as melting point, solubility, and spectral properties, would depend on the compound's purity and the conditions under which it is studied.
Formula:C8H6ClIN2O
InChI:InChI=1S/C8H6ClIN2O/c1-13-6-3-4(9)2-5-7(6)8(10)12-11-5/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=OSCDEUSAUZZHRV-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NN=C2I)=CC(Cl)=C1
Synonyms:- 6-Chloro-3-iodo-4-methoxy-1H-indazole
- 1H-Indazole, 6-chloro-3-iodo-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
