CAS 885519-73-3
:Methyl 3-chloro-6-nitro-1H-indazole-4-carboxylate
Description:
Methyl 3-chloro-6-nitro-1H-indazole-4-carboxylate, identified by its CAS number 885519-73-3, is a chemical compound that belongs to the indazole class of heterocyclic compounds. It features a nitro group and a chloro substituent, which contribute to its reactivity and potential applications in various fields, including medicinal chemistry. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitution. This compound is typically characterized by its molecular structure, which includes a five-membered indazole ring fused with a carboxylate moiety. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Methyl 3-chloro-6-nitro-1H-indazole-4-carboxylate may exhibit biological activity, making it of interest for research in drug development and synthesis of novel therapeutic agents. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C9H6ClN3O4
InChI:InChI=1S/C9H6ClN3O4/c1-17-9(14)5-2-4(13(15)16)3-6-7(5)8(10)12-11-6/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=KSLWKNQEBTTYLN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=CC(N(=O)=O)=C1)NN=C2Cl
Synonyms:- 1H-Indazole-4-carboxylic acid, 3-chloro-6-nitro-, methyl ester
- Methyl 3-chloro-6-nitro-1H-indazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
