CAS 885519-91-5
:6-Iodo-4-nitro-1H-indazole
Description:
6-Iodo-4-nitro-1H-indazole is a chemical compound characterized by its unique structure, which includes an indazole core substituted with both an iodine atom and a nitro group. The presence of the iodine atom at the 6-position and the nitro group at the 4-position contributes to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for biological activity, making it a candidate for further investigation in drug development. The nitro group can serve as a site for further chemical modifications, while the indazole framework is known for its diverse pharmacological properties. Safety and handling precautions should be observed due to the presence of the nitro group, which can be sensitive under certain conditions. Overall, 6-Iodo-4-nitro-1H-indazole represents a valuable compound for research and development in synthetic and medicinal chemistry.
Formula:C7H4IN3O2
InChI:InChI=1S/C7H4IN3O2/c8-4-1-6-5(3-9-10-6)7(2-4)11(12)13/h1-3H,(H,9,10)
InChI key:InChIKey=ZKYFPOXUPDVFCL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(I)=C1)NN=C2
Synonyms:- 6-Iodo-4-nitro-1H-indazole
- 1H-Indazole, 6-iodo-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
