CymitQuimica logo

CAS 885519-93-7

:

4-Hydroxy-1H-indazole-3-carboxylic acid

Description:
4-Hydroxy-1H-indazole-3-carboxylic acid, with the CAS number 885519-93-7, is a chemical compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a hydroxyl group (-OH) at the 4-position and a carboxylic acid group (-COOH) at the 3-position of the indazole ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl and carboxylic acid functional groups. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity for research and application purposes.
Formula:C8H6N2O3
InChI:InChI=1S/C8H6N2O3/c11-5-3-1-2-4-6(5)7(8(12)13)10-9-4/h1-3,11H,(H,9,10)(H,12,13)
InChI key:InChIKey=XWSXOIGNPIXBHE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NN1)=CC=CC2O
Synonyms:
  • 1H-Indazole-3-carboxylic acid, 4-hydroxy-
  • 4-Hydroxy-1H-indazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.