CAS 885520-06-9

1H-Indazole-3,5-dicarboxylic acid

Description:

1H-Indazole-3,5-dicarboxylic acid is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features two carboxylic acid functional groups located at the 3 and 5 positions of the indazole ring, contributing to its acidic properties. The presence of these carboxylic groups enhances its solubility in polar solvents and allows for potential interactions in biological systems. The compound is typically a white to off-white solid and may exhibit moderate stability under standard conditions. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential as a building block for more complex molecules or as a ligand in coordination chemistry. Additionally, its structural features may impart specific biological activities, making it a candidate for further research in drug development. As with many organic acids, it may participate in acid-base reactions and form salts with bases.

Formula: C₉H₆N₂O₄

InChI: InChI=1S/C9H6N2O4/c12-8(13)4-1-2-6-5(3-4)7(9(14)15)11-10-6/h1-3H,(H,10,11)(H,12,13)(H,14,15)

InChI key: InChIKey=AELBMCHGLKYEOP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NN1)=CC=C(C(O)=O)C2

Synonyms:

• 1H-Indazole-3,5-dicarboxylic acid