CAS 885520-18-3
:7-bromo-1H-indazole-3-carboxylic acid
Description:
7-Bromo-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 7-position and a carboxylic acid functional group at the 3-position contributes to its unique reactivity and properties. This compound typically appears as a solid and is soluble in polar solvents, making it suitable for various chemical reactions and applications in medicinal chemistry. The carboxylic acid group can participate in acid-base reactions, while the bromine atom can serve as a site for nucleophilic substitution or coupling reactions. Its structural features suggest potential biological activity, making it of interest in drug discovery and development. Additionally, the compound's CAS number, 885520-18-3, allows for easy identification and retrieval of information in chemical databases. Overall, 7-bromo-1H-indazole-3-carboxylic acid is a versatile compound with significant implications in research and industry.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-5-3-1-2-4-6(5)10-11-7(4)8(12)13/h1-3H,(H,10,11)(H,12,13)
SMILES:c1cc2c(c(c1)Br)[nH]nc2C(=O)O
Synonyms:- 1H-indazole-3-carboxylic acid, 7-bromo-
- 7-Bromo-1H-indazole-3-carboxylicacid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
