CAS 885520-19-4
:6-Fluoro-1,2-dihydro-4-nitro-3H-indazol-3-one
Description:
6-Fluoro-1,2-dihydro-4-nitro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluoro group at the 6-position and a nitro group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its nitro group can participate in various chemical reactions, making it a candidate for further functionalization. The fluorine atom can influence the compound's electronic properties and lipophilicity, potentially affecting its pharmacokinetics if evaluated for medicinal chemistry applications. Additionally, the indazole framework is often associated with various biological activities, including anti-inflammatory and anticancer properties. As with many synthetic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of this compound may not be fully characterized.
Formula:C7H4FN3O3
InChI:InChI=1S/C7H4FN3O3/c8-3-1-4-6(7(12)10-9-4)5(2-3)11(13)14/h1-2H,(H2,9,10,12)
InChI key:InChIKey=MDOWXHWFWNDJBI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NNC2=O)=CC(F)=C1
Synonyms:- 3H-Indazol-3-one, 6-fluoro-1,2-dihydro-4-nitro-
- 6-Fluoro-1,2-dihydro-4-nitro-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.