CAS 885520-21-8
:4-Amino-6-fluoro-1,2-dihydro-3H-indazol-3-one
Description:
4-Amino-6-fluoro-1,2-dihydro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which features a fluorine atom and an amino group at specific positions on the ring structure. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for many nitrogen-containing heterocycles. The presence of the amino group suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological targets. The fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit specific biological activities, which can be explored through various assays. Its molecular structure allows for potential applications in drug design, especially in targeting specific enzymes or receptors. As with many chemical substances, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C7H6FN3O
InChI:InChI=1S/C7H6FN3O/c8-3-1-4(9)6-5(2-3)10-11-7(6)12/h1-2H,9H2,(H2,10,11,12)
InChI key:InChIKey=NUZBSLSAVSYKHE-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(F)=C1)NNC2=O
Synonyms:- 3H-Indazol-3-one, 4-amino-6-fluoro-1,2-dihydro-
- 4-Amino-6-fluoro-1,2-dihydro-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
