CAS 885520-22-9
:4-Chloro-1H-indol-6-amine
Description:
4-Chloro-1H-indol-6-amine is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 4-position and an amino group at the 6-position of the indole ring contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. It is often utilized in medicinal chemistry and research due to its potential biological activity, including roles in drug development and as a building block for synthesizing more complex molecules. The compound may exhibit various functional properties, such as acting as a ligand in biological systems or participating in chemical reactions typical of amines and halogenated compounds. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 4-Chloro-1H-indol-6-amine is a significant compound in the field of organic chemistry and pharmacology.
Formula:C8H7ClN2
InChI:InChI=1S/C8H7ClN2/c9-7-3-5(10)4-8-6(7)1-2-11-8/h1-4,11H,10H2
InChI key:InChIKey=GOASCBLEUIJTBB-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(N)=C1)NC=C2
Synonyms:- 4-Chloro-1H-indol-6-amine
- 1H-Indol-6-amine, 4-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
