CymitQuimica logo

CAS 885520-36-5

:

4,6-dimethoxy-1H-indazole-3-carboxylic acid

Description:
4,6-Dimethoxy-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features two methoxy groups (-OCH3) at the 4 and 6 positions of the indazole ring, contributing to its unique chemical properties and potential biological activity. The presence of a carboxylic acid group (-COOH) at the 3 position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially influencing its efficacy in therapeutic applications. Additionally, the methoxy groups can affect the compound's lipophilicity and overall reactivity. As with many indazole derivatives, 4,6-dimethoxy-1H-indazole-3-carboxylic acid may be explored for its potential in drug development, particularly in areas such as anti-inflammatory or anticancer research.
Formula:C10H10N2O4
InChI:InChI=1/C10H10N2O4/c1-15-5-3-6-8(7(4-5)16-2)9(10(13)14)12-11-6/h3-4H,1-2H3,(H,11,12)(H,13,14)
SMILES:COc1cc2c(c(c1)OC)c(C(=O)O)n[nH]2
Synonyms:
  • 1H-indazole-3-carboxylic acid, 4,6-dimethoxy-
  • 4,6-Dimethoxy-1H-indazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.