CAS 885520-37-6
:4,6-Diiodo-1H-indole
Description:
4,6-Diiodo-1H-indole is a chemical compound characterized by the presence of two iodine atoms attached to the indole structure at the 4 and 6 positions. Indole itself is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring, which contributes to its aromatic properties. The introduction of iodine atoms enhances the compound's reactivity and can influence its electronic properties, making it of interest in various chemical applications, including organic synthesis and medicinal chemistry. The presence of halogens like iodine can also affect the compound's solubility, stability, and biological activity. 4,6-Diiodo-1H-indole may be utilized in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its unique structural features. Additionally, its properties can be further explored in research related to materials science and dye chemistry. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C8H5I2N
InChI:InChI=1S/C8H5I2N/c9-5-3-7(10)6-1-2-11-8(6)4-5/h1-4,11H
InChI key:InChIKey=ZITYWKTZRRHYBA-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(I)=C1)NC=C2
Synonyms:- 4,6-Diiodo-1H-indole
- 1H-Indole, 4,6-diiodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
