CAS 885520-40-1
:4-Iodo-1H-indol-6-ol
Description:
4-Iodo-1H-indol-6-ol, with the CAS number 885520-40-1, is a chemical compound that belongs to the indole family, characterized by its fused bicyclic structure containing a six-membered benzene ring and a five-membered nitrogen-containing pyrrole ring. This compound features an iodine atom at the 4-position and a hydroxyl group at the 6-position of the indole structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the iodine atom can enhance its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its interactions in biological systems. 4-Iodo-1H-indol-6-ol may have applications in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or as a building block in organic synthesis.
Formula:C8H6INO
InChI:InChI=1S/C8H6INO/c9-7-3-5(11)4-8-6(7)1-2-10-8/h1-4,10-11H
InChI key:InChIKey=AXWXUWTVKWLREV-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(O)=C1)NC=C2
Synonyms:- 4-Iodo-1H-indol-6-ol
- 1H-Indol-6-ol, 4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
