CAS 885520-44-5
:6-Nitro-1H-indol-4-amine
Description:
6-Nitro-1H-indol-4-amine, with the CAS number 885520-44-5, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a nitro group at the 6-position and an amino group at the 4-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, while the nitro group can influence its electronic properties and reactivity. 6-Nitro-1H-indol-4-amine is of interest in various fields, including medicinal chemistry, where it may serve as a building block for the synthesis of biologically active molecules. Its potential applications could extend to areas such as drug development, where modifications to its structure might enhance pharmacological properties. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-7-3-5(11(12)13)4-8-6(7)1-2-10-8/h1-4,10H,9H2
InChI key:InChIKey=BIPDYNQMNKZUFH-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(N(=O)=O)=C1)NC=C2
Synonyms:- 6-Nitro-1H-indol-4-amine
- 1H-Indol-4-amine, 6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
