CAS 885520-52-5
:1H-Indol-6-amine, 4-iodo-
Description:
1H-Indol-6-amine, 4-iodo- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of an amino group (-NH2) at the 6-position and an iodine atom at the 4-position of the indole ring defines its chemical identity. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups present. It is of interest in medicinal chemistry and research due to its potential biological activity, including applications in drug development and as a building block for synthesizing more complex molecules. The iodine substituent can influence the compound's reactivity and interactions, making it a valuable target for further chemical modifications. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.
Formula:C8H7IN2
InChI:InChI=1S/C8H7IN2/c9-7-3-5(10)4-8-6(7)1-2-11-8/h1-4,11H,10H2
InChI key:InChIKey=PERZAHBZMHCPCV-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(N)=C1)NC=C2
Synonyms:- 4-Iodo-1H-indol-6-amine
- 1H-Indol-6-amine, 4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
