CymitQuimica logo

CAS 885520-54-7

:

4-Iodo-6-nitro-1H-indole

Description:
4-Iodo-6-nitro-1H-indole is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features an iodine atom at the 4-position and a nitro group at the 6-position of the indole ring, which contributes to its unique reactivity and properties. It is typically a yellow to orange solid, and its molecular structure imparts specific electronic and steric characteristics that can influence its behavior in chemical reactions. The presence of the nitro group makes it a potential electrophile, while the iodine atom can participate in various substitution reactions. 4-Iodo-6-nitro-1H-indole may be utilized in organic synthesis, medicinal chemistry, and as a building block for more complex molecules. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. As with many halogenated compounds, it may exhibit biological activity, warranting further investigation in pharmacological contexts.
Formula:C8H5IN2O2
InChI:InChI=1S/C8H5IN2O2/c9-7-3-5(11(12)13)4-8-6(7)1-2-10-8/h1-4,10H
InChI key:InChIKey=UMLHWZLRBBQYFO-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(N(=O)=O)=C1)NC=C2
Synonyms:
  • 4-Iodo-6-nitro-1H-indole
  • 1H-Indole, 4-iodo-6-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.