CAS 885520-57-0
:6-Hydroxy-1H-indole-4-carboxylic acid
Description:
6-Hydroxy-1H-indole-4-carboxylic acid, with the CAS number 885520-57-0, is an organic compound that features a bicyclic indole structure with a hydroxyl group and a carboxylic acid functional group. This compound is characterized by its aromatic properties due to the indole moiety, which contributes to its potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The carboxylic acid group can participate in hydrogen bonding and may play a role in the compound's acidity and reactivity. This substance is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug development and as a biochemical probe. Its structural features suggest that it may exhibit antioxidant properties and could interact with various biological targets, making it a subject of research in pharmacology and related disciplines.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c11-5-3-7(9(12)13)6-1-2-10-8(6)4-5/h1-4,10-11H,(H,12,13)
InChI key:InChIKey=DVBOUYCBVGMBMR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(O)=C1)NC=C2
Synonyms:- 1H-Indole-4-carboxylic acid, 6-hydroxy-
- 6-Hydroxy-1H-indole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
