CAS 885520-60-5

6-Methoxy-1H-indole-4-carboxylic acid

Description:

6-Methoxy-1H-indole-4-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a methoxy group (-OCH3) at the 6-position and a carboxylic acid group (-COOH) at the 4-position of the indole ring, contributing to its chemical reactivity and solubility properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is influenced by the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the study of indole derivatives that can interact with various biological targets. Its molecular structure allows for potential hydrogen bonding and interactions with other molecules, which can be significant in drug design and development. As with many organic compounds, proper handling and storage are essential to maintain its stability and efficacy.

Formula: C₁₀H₉NO₃

InChI: InChI=1S/C10H9NO3/c1-14-6-4-8(10(12)13)7-2-3-11-9(7)5-6/h2-5,11H,1H3,(H,12,13)

InChI key: InChIKey=RUUYNZLHRCOJQI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CC(OC)=C1)NC=C2

Synonyms:

• 1H-Indole-4-carboxylic acid, 6-methoxy-
• 6-Methoxy-1H-indole-4-carboxylic acid