CAS 885520-64-9
:4,6-Dichloro-1H-indazole-3-carboxylic acid
Description:
4,6-Dichloro-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which features two chlorine substituents at the 4 and 6 positions and a carboxylic acid group at the 3 position. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. The carboxylic acid group contributes to its acidity and solubility in polar solvents, making it suitable for various chemical reactions and formulations. Additionally, the compound's structure allows for potential interactions with biological targets, which is of interest in drug discovery. As with many halogenated compounds, it is important to handle 4,6-Dichloro-1H-indazole-3-carboxylic acid with care due to potential toxicity and environmental concerns associated with chlorinated organic compounds.
Formula:C8H4Cl2N2O2
InChI:InChI=1S/C8H4Cl2N2O2/c9-3-1-4(10)6-5(2-3)11-12-7(6)8(13)14/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=WOZHSPNLKJFNNE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(Cl)=CC2Cl)NN1
Synonyms:- 1H-Indazole-3-carboxylic acid, 4,6-dichloro-
- 4,6-Dichloro-1H-indazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.