CAS 885520-65-0

4-Bromo-6-fluoro-1H-indazole-3-carboxylic acid

Description:

4-Bromo-6-fluoro-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of bromine and fluorine substituents at the 4 and 6 positions, respectively, contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and allows for potential interactions in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens can influence its electronic properties, potentially affecting its biological activity. Overall, 4-Bromo-6-fluoro-1H-indazole-3-carboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₄BrFN₂O₂

InChI: InChI=1S/C8H4BrFN2O2/c9-4-1-3(10)2-5-6(4)7(8(13)14)12-11-5/h1-2H,(H,11,12)(H,13,14)

InChI key: InChIKey=KLAHIEDAPOFRDG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(=CC(F)=CC2Br)NN1

Synonyms:

• 1H-Indazole-3-carboxylic acid, 4-bromo-6-fluoro-
• 4-Bromo-6-fluoro-1H-indazole-3-carboxylic acid
• 4-BROMO-6-FLUORO-3-(1H)INDAZOLE CARBOXYLIC ACID