CAS 885520-75-2

4-Chloro-6-fluoro-1H-indazole-3-carboxylic acid

Description:

4-Chloro-6-fluoro-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chloro group at the 4-position and a fluoro group at the 6-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and amidation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the presence of halogen substituents often influences the compound's lipophilicity and metabolic stability. Overall, 4-Chloro-6-fluoro-1H-indazole-3-carboxylic acid is a versatile compound with potential implications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₄ClFN₂O₂

InChI: InChI=1S/C8H4ClFN2O2/c9-4-1-3(10)2-5-6(4)7(8(13)14)12-11-5/h1-2H,(H,11,12)(H,13,14)

InChI key: InChIKey=OJZBYKZKAFIYEN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(=CC(F)=CC2Cl)NN1

Synonyms:

• 4-Chloro-6-fluoro-1H-indazole-3-carboxylic acid
• 1H-Indazole-3-carboxylic acid, 4-chloro-6-fluoro-