CAS 885520-80-9
:3-Iodo-1H-indazole-4-carboxylic acid
Description:
3-Iodo-1H-indazole-4-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position and a carboxylic acid functional group at the 4-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential for hydrogen bonding, which can influence its physical properties and interactions with biological targets. The compound may be of interest in research related to pharmaceuticals, particularly in the development of new therapeutic agents, due to the biological activity often associated with indazole derivatives. Additionally, the iodine substituent can enhance the compound's lipophilicity and may play a role in its biological activity or in facilitating radiolabeling for imaging studies.
Formula:C8H5IN2O2
InChI:InChI=1S/C8H5IN2O2/c9-7-6-4(8(12)13)2-1-3-5(6)10-11-7/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=POTWVYVTMBLLKR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC=C1)NN=C2I
Synonyms:- 1H-Indazole-4-carboxylic acid, 3-iodo-
- 3-Iodo-1H-indazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
