
CAS 885520-82-1
:6-Chloro-4-fluoro-1H-indazole-3-carboxylic acid
Description:
6-Chloro-4-fluoro-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and a fluorine atom at the 4-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound is of interest in medicinal chemistry and drug development due to its potential as a pharmacophore, which may exhibit anti-inflammatory or anticancer properties. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the substituents on the indazole ring, which may affect its pharmacokinetic and pharmacodynamic profiles.
Formula:C8H4ClFN2O2
InChI:InChI=1S/C8H4ClFN2O2/c9-3-1-4(10)6-5(2-3)11-12-7(6)8(13)14/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=CPMWCECFUCHQPS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(Cl)=CC2F)NN1
Synonyms:- 6-Chloro-4-fluoro-1H-indazole-3-carboxylic acid
- 1H-Indazole-3-carboxylic acid, 6-chloro-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.