CAS 885520-87-6

6-Chloro-4-methyl-1H-indazole

Description:

6-Chloro-4-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and a methyl group at the 4-position contributes to its unique properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. It may exhibit biological activity, making it of interest in research related to drug discovery. The molecular structure influences its solubility, stability, and reactivity, which are critical for its use in various chemical reactions and applications. Additionally, the compound's safety and handling considerations should be taken into account, as with many halogenated organic compounds, due to potential toxicity or environmental impact. Overall, 6-Chloro-4-methyl-1H-indazole represents a significant compound in the field of organic chemistry and pharmacology.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c1-5-2-6(9)3-8-7(5)4-10-11-8/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=JDLULNKWAGWMEO-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC(Cl)=C1)NN=C2

Synonyms:

• 6-Chloro-4-methyl-1H-indazole
• 1H-Indazole, 6-chloro-4-methyl-