CAS 885520-88-7

6-Chloro-4-fluoro-1H-indole

Description:

6-Chloro-4-fluoro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of chlorine and fluorine substituents at the 6 and 4 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature. It is often used in pharmaceutical research and development due to its potential biological activity, particularly in the field of medicinal chemistry. The presence of halogen atoms can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting interactions with biological targets, which can be explored for therapeutic applications. Safety data sheets and handling guidelines should be consulted for proper safety measures, as with any chemical substance.

Formula: C₈H₅ClFN

InChI: InChI=1S/C8H5ClFN/c9-5-3-7(10)6-1-2-11-8(6)4-5/h1-4,11H

SMILES: c1c[nH]c2cc(cc(c12)F)Cl

Synonyms:

• 1H-Indole, 6-chloro-4-fluoro-
• 6-Chloro-4-fluoro-1H-indole

6-Chloro-4-fluoro-1H-indole

CAS: 885520-88-7

Formula: C₈H₅ClFN

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.5834

Ref: IN-DA00IF6V

6-Chloro-4-fluoro-1H-indole

CAS: 885520-88-7

6-Chloro-4-fluoro-1H-indole

Purity: 97%

Molecular weight: 169.58g/mol

Ref: 54-PC402045

6-Chloro-4-fluoro-1H-indole

CAS: 885520-88-7

Formula: C₈H₅ClFN

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.58

Ref: 10-F337218